C13H14N2O2 — CID 13136926
9-amino-8-methyl-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one (PubChem CID 13136926) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 9-amino-8-methyl-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one.
| Compound Name | 9-amino-8-methyl-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 13136926 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 9-amino-8-methyl-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one |
| SMILES | Cc1cc2oc(=O)c3c(c2cc1N)CCNC3 |
| InChI | InChI=1S/C13H14N2O2/c1-7-4-12-9(5-11(7)14)8-2-3-15-6-10(8)13(16)17-12/h4-5,15H,2-3,6,14H2,1H3 |
| InChIKey | ALMJILAVZBDQET-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|