C8H7F5N2 — CID 131371192
(1R)-2,2,3,3,3-pentafluoro-1-pyridin-3-ylpropan-1-amine (PubChem CID 131371192) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-pyridin-3-ylpropan-1-amine.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 131371192 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-pyridin-3-ylpropan-1-amine |
| SMILES | N[C@H](c1cccnc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2/c9-7(10,8(11,12)13)6(14)5-2-1-3-15-4-5/h1-4,6H,14H2/t6-/m1/s1 |
| InChIKey | UPIKYAAXXIPMCZ-ZCFIWIBFSA-N |
| XLogP | 2.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|