C19H26O3 — CID 13137195
5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 13137195) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 13137195 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C19H26O3/c1-13(2)6-4-7-14(3)8-5-9-15-10-11-16-17(12-15)19(21)22-18(16)20/h6,8,10,16-17H,4-5,7,9,11-12H2,1-3H3/b14-8+ |
| InChIKey | BZVOJBNKYQYFHZ-RIYZIHGNSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|