About 2-(2-bromophenyl)-1,3-dimethylimidazolidine
2-(2-bromophenyl)-1,3-dimethylimidazolidine (PubChem CID 13137337) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,3-dimethylimidazolidine.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-1,3-dimethylimidazolidine |
| PubChem CID | 13137337 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(2-bromophenyl)-1,3-dimethylimidazolidine |
| SMILES | CN1CCN(C)C1c1ccccc1Br |
| InChI | InChI=1S/C11H15BrN2/c1-13-7-8-14(2)11(13)9-5-3-4-6-10(9)12/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | HBCCEEZEQUQQCN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-bromophenyl)-1,3-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-1,3-dimethylimidazolidine?
The IUPAC name of 2-(2-bromophenyl)-1,3-dimethylimidazolidine (CID 13137337) is 2-(2-bromophenyl)-1,3-dimethylimidazolidine.
What is the SMILES notation for 2-(2-bromophenyl)-1,3-dimethylimidazolidine?
The canonical SMILES for 2-(2-bromophenyl)-1,3-dimethylimidazolidine is CN1CCN(C)C1c1ccccc1Br.
What is the InChIKey of 2-(2-bromophenyl)-1,3-dimethylimidazolidine?
The InChIKey is HBCCEEZEQUQQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2/c1-13-7-8-14(2)11(13)9-5-3-4-6-10(9)12/h3-6,11H,7-8H2,1-2H3.
What are the key properties of 2-(2-bromophenyl)-1,3-dimethylimidazolidine?
2-(2-bromophenyl)-1,3-dimethylimidazolidine has a molecular weight of 255.16 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-1,3-dimethylimidazolidine is sourced from PubChem (CID 13137337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).