C11H7BrN2O — CID 131377751
5-(3-bromo-2-oxopropyl)benzene-1,3-dicarbonitrile (PubChem CID 131377751) has the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. Its IUPAC name is 5-(3-bromo-2-oxopropyl)benzene-1,3-dicarbonitrile.
| Compound Name | 5-(3-bromo-2-oxopropyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 131377751 |
| Molecular Formula | C11H7BrN2O |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 5-(3-bromo-2-oxopropyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(CC(=O)CBr)c1 |
| InChI | InChI=1S/C11H7BrN2O/c12-5-11(15)4-8-1-9(6-13)3-10(2-8)7-14/h1-3H,4-5H2 |
| InChIKey | ANXFKASUBNANBQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|