About (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine
(1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine (PubChem CID 131380842) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine |
| PubChem CID | 131380842 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(/C=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21N/c1-11(15)13-7-5-12(6-8-13)9-10-14(2,3)4/h5-11H,15H2,1-4H3/b10-9+/t11-/m1/s1 |
| InChIKey | HPKSCDSXZCQRKS-PBQZMEPESA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine?
The IUPAC name of (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine (CID 131380842) is (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine.
What is the SMILES notation for (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine?
The canonical SMILES for (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine is C[C@@H](N)c1ccc(/C=C/C(C)(C)C)cc1.
What is the InChIKey of (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine?
The InChIKey is HPKSCDSXZCQRKS-PBQZMEPESA-N. The full InChI is InChI=1S/C14H21N/c1-11(15)13-7-5-12(6-8-13)9-10-14(2,3)4/h5-11H,15H2,1-4H3/b10-9+/t11-/m1/s1.
What are the key properties of (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine?
(1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine has a molecular weight of 203.33 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]ethanamine is sourced from PubChem (CID 131380842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).