About cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane
cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane (PubChem CID 13138751) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane.
Molecular Properties
| Compound Name | cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane |
| PubChem CID | 13138751 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane |
| SMILES | C=C(C)[C@@H]1CCC[C@H](C)C1 |
| InChI | InChI=1S/C10H18/c1-8(2)10-6-4-5-9(3)7-10/h9-10H,1,4-7H2,2-3H3/t9-,10+/m0/s1 |
| InChIKey | WOUXRHNTGOLKPF-VHSXEESVSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane?
The IUPAC name of cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane (CID 13138751) is cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane.
What is the SMILES notation for cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane?
The canonical SMILES for cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane is C=C(C)[C@@H]1CCC[C@H](C)C1.
What is the InChIKey of cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane?
The InChIKey is WOUXRHNTGOLKPF-VHSXEESVSA-N. The full InChI is InChI=1S/C10H18/c1-8(2)10-6-4-5-9(3)7-10/h9-10H,1,4-7H2,2-3H3/t9-,10+/m0/s1.
What are the key properties of cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane?
cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane has a molecular weight of 138.25 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-1-methyl-3-prop-1-en-2-ylcyclohexane is sourced from PubChem (CID 13138751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).