About 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline
4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline (PubChem CID 13139019) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline |
| PubChem CID | 13139019 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2C=CC=CC2)cc1 |
| InChI | InChI=1S/C14H17N/c1-15(2)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-6,8-12H,7H2,1-2H3 |
| InChIKey | OQGTXUJMIMSBBR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline?
The IUPAC name of 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline (CID 13139019) is 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline.
What is the SMILES notation for 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline?
The canonical SMILES for 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline is CN(C)c1ccc(C2C=CC=CC2)cc1.
What is the InChIKey of 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline?
The InChIKey is OQGTXUJMIMSBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N/c1-15(2)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-6,8-12H,7H2,1-2H3.
What are the key properties of 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline?
4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline has a molecular weight of 199.30 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-2,4-dien-1-yl-N,N-dimethylaniline is sourced from PubChem (CID 13139019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).