About 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene
6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 13139159) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
Analyze 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene?
The IUPAC name of 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (CID 13139159) is 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
What is the SMILES notation for 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene?
The canonical SMILES for 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene is c1cc2c3cccn3ccn2c1.
What is the InChIKey of 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene?
The InChIKey is HONFRAYCCYDYSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-3-9-10-4-2-6-12(10)8-7-11(9)5-1/h1-8H.
What are the key properties of 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene?
6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene has a molecular weight of 156.19 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene is sourced from PubChem (CID 13139159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).