About [(Z)-2-cyanoethenyl] propanoate
[(Z)-2-cyanoethenyl] propanoate (PubChem CID 13139287) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is [(Z)-2-cyanoethenyl] propanoate.
Molecular Properties
| Compound Name | [(Z)-2-cyanoethenyl] propanoate |
| PubChem CID | 13139287 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | [(Z)-2-cyanoethenyl] propanoate |
| SMILES | CCC(=O)O/C=C\C#N |
| InChI | InChI=1S/C6H7NO2/c1-2-6(8)9-5-3-4-7/h3,5H,2H2,1H3/b5-3- |
| InChIKey | WFQIEOPQNCSFHD-HYXAFXHYSA-N |
| XLogP | 0.98 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-cyanoethenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-cyanoethenyl] propanoate?
The IUPAC name of [(Z)-2-cyanoethenyl] propanoate (CID 13139287) is [(Z)-2-cyanoethenyl] propanoate.
What is the SMILES notation for [(Z)-2-cyanoethenyl] propanoate?
The canonical SMILES for [(Z)-2-cyanoethenyl] propanoate is CCC(=O)O/C=C\C#N.
What is the InChIKey of [(Z)-2-cyanoethenyl] propanoate?
The InChIKey is WFQIEOPQNCSFHD-HYXAFXHYSA-N. The full InChI is InChI=1S/C6H7NO2/c1-2-6(8)9-5-3-4-7/h3,5H,2H2,1H3/b5-3-.
What are the key properties of [(Z)-2-cyanoethenyl] propanoate?
[(Z)-2-cyanoethenyl] propanoate has a molecular weight of 125.13 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-cyanoethenyl] propanoate is sourced from PubChem (CID 13139287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).