About 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane
4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 13140009) has the molecular formula C8H17BO2
and a molecular weight of 156.03 g/mol. Its IUPAC name is 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| PubChem CID | 13140009 |
| Molecular Formula | C8H17BO2 |
| Molecular Weight | 156.03 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC(C)B1OCC(C)C(C)O1 |
| InChI | InChI=1S/C8H17BO2/c1-6(2)9-10-5-7(3)8(4)11-9/h6-8H,5H2,1-4H3 |
| InChIKey | WVHROWVCOCVMAQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane?
The IUPAC name of 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane (CID 13140009) is 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane.
What is the SMILES notation for 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane?
The canonical SMILES for 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane is CC(C)B1OCC(C)C(C)O1.
What is the InChIKey of 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane?
The InChIKey is WVHROWVCOCVMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BO2/c1-6(2)9-10-5-7(3)8(4)11-9/h6-8H,5H2,1-4H3.
What are the key properties of 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane?
4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane has a molecular weight of 156.03 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane is sourced from PubChem (CID 13140009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).