About 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid
5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 131400101) has the molecular formula C8H6N2O4
and a molecular weight of 194.15 g/mol. Its IUPAC name is 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 131400101 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1cc(-c2oncc2C(=O)O)no1 |
| InChI | InChI=1S/C8H6N2O4/c1-4-2-6(10-13-4)7-5(8(11)12)3-9-14-7/h2-3H,1H3,(H,11,12) |
| InChIKey | WRBYTRLMESWPMK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid (CID 131400101) is 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid is Cc1cc(-c2oncc2C(=O)O)no1.
What is the InChIKey of 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
The InChIKey is WRBYTRLMESWPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O4/c1-4-2-6(10-13-4)7-5(8(11)12)3-9-14-7/h2-3H,1H3,(H,11,12).
What are the key properties of 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid has a molecular weight of 194.15 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 131400101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).