C23H22N2O2S — CID 1314014
N-(3-pyrrolidin-1-ylphenyl)-9H-fluorene-2-sulfonamide (PubChem CID 1314014) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylphenyl)-9H-fluorene-2-sulfonamide.
| Compound Name | N-(3-pyrrolidin-1-ylphenyl)-9H-fluorene-2-sulfonamide |
|---|---|
| PubChem CID | 1314014 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(3-pyrrolidin-1-ylphenyl)-9H-fluorene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(N2CCCC2)c1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C23H22N2O2S/c26-28(27,24-19-7-5-8-20(16-19)25-12-3-4-13-25)21-10-11-23-18(15-21)14-17-6-1-2-9-22(17)23/h1-2,5-11,15-16,24H,3-4,12-14H2 |
| InChIKey | MTQJAGPUYZQOGM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_H(6)', 'substructure': 'N/A'} |
|---|