About 1-bromo-3,7-ditert-butylnaphthalene
1-bromo-3,7-ditert-butylnaphthalene (PubChem CID 13140367) has the molecular formula C18H23Br
and a molecular weight of 319.29 g/mol. Its IUPAC name is 1-bromo-3,7-ditert-butylnaphthalene.
Molecular Properties
| Compound Name | 1-bromo-3,7-ditert-butylnaphthalene |
| PubChem CID | 13140367 |
| Molecular Formula | C18H23Br |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-bromo-3,7-ditert-butylnaphthalene |
| SMILES | CC(C)(C)c1cc(Br)c2cc(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C18H23Br/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(19)15(12)10-13/h7-11H,1-6H3 |
| InChIKey | NANSFSIRYJQRSA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3,7-ditert-butylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,7-ditert-butylnaphthalene?
The IUPAC name of 1-bromo-3,7-ditert-butylnaphthalene (CID 13140367) is 1-bromo-3,7-ditert-butylnaphthalene.
What is the SMILES notation for 1-bromo-3,7-ditert-butylnaphthalene?
The canonical SMILES for 1-bromo-3,7-ditert-butylnaphthalene is CC(C)(C)c1cc(Br)c2cc(C(C)(C)C)ccc2c1.
What is the InChIKey of 1-bromo-3,7-ditert-butylnaphthalene?
The InChIKey is NANSFSIRYJQRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23Br/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(19)15(12)10-13/h7-11H,1-6H3.
What are the key properties of 1-bromo-3,7-ditert-butylnaphthalene?
1-bromo-3,7-ditert-butylnaphthalene has a molecular weight of 319.29 g/mol, XLogP of 6.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,7-ditert-butylnaphthalene is sourced from PubChem (CID 13140367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).