About benzyl N-cyclopropylcarbamate
benzyl N-cyclopropylcarbamate (PubChem CID 13141013) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is benzyl N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | benzyl N-cyclopropylcarbamate |
| PubChem CID | 13141013 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | benzyl N-cyclopropylcarbamate |
| SMILES | O=C(NC1CC1)OCc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c13-11(12-10-6-7-10)14-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13) |
| InChIKey | ANHOWPBVPPIHML-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-cyclopropylcarbamate?
The IUPAC name of benzyl N-cyclopropylcarbamate (CID 13141013) is benzyl N-cyclopropylcarbamate.
What is the SMILES notation for benzyl N-cyclopropylcarbamate?
The canonical SMILES for benzyl N-cyclopropylcarbamate is O=C(NC1CC1)OCc1ccccc1.
What is the InChIKey of benzyl N-cyclopropylcarbamate?
The InChIKey is ANHOWPBVPPIHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(12-10-6-7-10)14-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13).
What are the key properties of benzyl N-cyclopropylcarbamate?
benzyl N-cyclopropylcarbamate has a molecular weight of 191.23 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-cyclopropylcarbamate is sourced from PubChem (CID 13141013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).