C17H20BrN3O5S2 — CID 1314108
2-(4-bromo-N-methylsulfonylanilino)-N-[3-[methyl(methylsulfonyl)amino]phenyl]acetamide (PubChem CID 1314108) has the molecular formula C17H20BrN3O5S2 and a molecular weight of 490.40 g/mol. Its IUPAC name is 2-(4-bromo-N-methylsulfonylanilino)-N-[3-[methyl(methylsulfonyl)amino]phenyl]acetamide.
| Compound Name | 2-(4-bromo-N-methylsulfonylanilino)-N-[3-[methyl(methylsulfonyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 1314108 |
| Molecular Formula | C17H20BrN3O5S2 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 2-(4-bromo-N-methylsulfonylanilino)-N-[3-[methyl(methylsulfonyl)amino]phenyl]acetamide |
| SMILES | CN(c1cccc(NC(=O)CN(c2ccc(Br)cc2)S(C)(=O)=O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H20BrN3O5S2/c1-20(27(2,23)24)16-6-4-5-14(11-16)19-17(22)12-21(28(3,25)26)15-9-7-13(18)8-10-15/h4-11H,12H2,1-3H3,(H,19,22) |
| InChIKey | ZHUHCJNCERPQLK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |