C18H20N2O4 — CID 13141156
ethyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 13141156) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 13141156 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | ethyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1ncc2[nH]c3cc(OC)c(OC)cc3c2c1CC |
| InChI | InChI=1S/C18H20N2O4/c1-5-10-16-11-7-14(22-3)15(23-4)8-12(11)20-13(16)9-19-17(10)18(21)24-6-2/h7-9,20H,5-6H2,1-4H3 |
| InChIKey | QRZNWQBPKJMWHT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |