About 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine
4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine (PubChem CID 13141416) has the molecular formula C13H11N3OS
and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine.
Molecular Properties
| Compound Name | 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine |
| PubChem CID | 13141416 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine |
| SMILES | COc1ncnc2c1N=C(c1ccccc1)CS2 |
| InChI | InChI=1S/C13H11N3OS/c1-17-12-11-13(15-8-14-12)18-7-10(16-11)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | FKZDAMCOTFEZCL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine?
The IUPAC name of 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine (CID 13141416) is 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine.
What is the SMILES notation for 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine?
The canonical SMILES for 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine is COc1ncnc2c1N=C(c1ccccc1)CS2.
What is the InChIKey of 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine?
The InChIKey is FKZDAMCOTFEZCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3OS/c1-17-12-11-13(15-8-14-12)18-7-10(16-11)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What are the key properties of 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine?
4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine has a molecular weight of 257.32 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-phenyl-7H-pyrimido[4,5-b][1,4]thiazine is sourced from PubChem (CID 13141416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).