About N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide
N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 13141782) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| PubChem CID | 13141782 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CCNC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C8H14N2O/c1-2-9-8(11)10-6-4-3-5-7-10/h3-4H,2,5-7H2,1H3,(H,9,11) |
| InChIKey | UTCHOQRZUIFGFJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The IUPAC name of N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide (CID 13141782) is N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide.
What is the SMILES notation for N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The canonical SMILES for N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide is CCNC(=O)N1CC=CCC1.
What is the InChIKey of N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The InChIKey is UTCHOQRZUIFGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-2-9-8(11)10-6-4-3-5-7-10/h3-4H,2,5-7H2,1H3,(H,9,11).
What are the key properties of N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide?
N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide has a molecular weight of 154.21 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,6-dihydro-2H-pyridine-1-carboxamide is sourced from PubChem (CID 13141782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).