C9H13F4N — CID 131420449
2-[(E)-4,4,5,5-tetrafluoropent-2-en-2-yl]pyrrolidine (PubChem CID 131420449) has the molecular formula C9H13F4N and a molecular weight of 211.20 g/mol. Its IUPAC name is 2-[(E)-4,4,5,5-tetrafluoropent-2-en-2-yl]pyrrolidine.
| Compound Name | 2-[(E)-4,4,5,5-tetrafluoropent-2-en-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 131420449 |
| Molecular Formula | C9H13F4N |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[(E)-4,4,5,5-tetrafluoropent-2-en-2-yl]pyrrolidine |
| SMILES | C/C(=C\C(F)(F)C(F)F)C1CCCN1 |
| InChI | InChI=1S/C9H13F4N/c1-6(7-3-2-4-14-7)5-9(12,13)8(10)11/h5,7-8,14H,2-4H2,1H3/b6-5+ |
| InChIKey | CUOCKOHTQBOAFD-AATRIKPKSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|