About 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine
5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 13142206) has the molecular formula C8H5ClFN3S
and a molecular weight of 229.67 g/mol. Its IUPAC name is 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 13142206 |
| Molecular Formula | C8H5ClFN3S |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2c(F)cccc2Cl)s1 |
| InChI | InChI=1S/C8H5ClFN3S/c9-4-2-1-3-5(10)6(4)7-12-13-8(11)14-7/h1-3H,(H2,11,13) |
| InChIKey | QMVHYPVHVBSJCN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine (CID 13142206) is 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine is Nc1nnc(-c2c(F)cccc2Cl)s1.
What is the InChIKey of 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is QMVHYPVHVBSJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClFN3S/c9-4-2-1-3-5(10)6(4)7-12-13-8(11)14-7/h1-3H,(H2,11,13).
What are the key properties of 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine?
5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 229.67 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-6-fluorophenyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 13142206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).