About (3E)-3-ethylidene-1,2-dihydroindol-4-ol
(3E)-3-ethylidene-1,2-dihydroindol-4-ol (PubChem CID 131423207) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is (3E)-3-ethylidene-1,2-dihydroindol-4-ol.
Molecular Properties
| Compound Name | (3E)-3-ethylidene-1,2-dihydroindol-4-ol |
| PubChem CID | 131423207 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (3E)-3-ethylidene-1,2-dihydroindol-4-ol |
| SMILES | C/C=C1/CNc2cccc(O)c21 |
| InChI | InChI=1S/C10H11NO/c1-2-7-6-11-8-4-3-5-9(12)10(7)8/h2-5,11-12H,6H2,1H3/b7-2- |
| InChIKey | NPSYWJDDZHAXHN-UQCOIBPSSA-N |
| XLogP | 2.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3E)-3-ethylidene-1,2-dihydroindol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-ethylidene-1,2-dihydroindol-4-ol?
The IUPAC name of (3E)-3-ethylidene-1,2-dihydroindol-4-ol (CID 131423207) is (3E)-3-ethylidene-1,2-dihydroindol-4-ol.
What is the SMILES notation for (3E)-3-ethylidene-1,2-dihydroindol-4-ol?
The canonical SMILES for (3E)-3-ethylidene-1,2-dihydroindol-4-ol is C/C=C1/CNc2cccc(O)c21.
What is the InChIKey of (3E)-3-ethylidene-1,2-dihydroindol-4-ol?
The InChIKey is NPSYWJDDZHAXHN-UQCOIBPSSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-7-6-11-8-4-3-5-9(12)10(7)8/h2-5,11-12H,6H2,1H3/b7-2-.
What are the key properties of (3E)-3-ethylidene-1,2-dihydroindol-4-ol?
(3E)-3-ethylidene-1,2-dihydroindol-4-ol has a molecular weight of 161.20 g/mol, XLogP of 2.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethylidene-1,2-dihydroindol-4-ol is sourced from PubChem (CID 131423207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).