About methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate
methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate (PubChem CID 131423907) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate.
Analyze methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate?
The IUPAC name of methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate (CID 131423907) is methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate.
What is the SMILES notation for methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate?
The canonical SMILES for methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate is COC(=O)c1cnn2c1CNCC2.
What is the InChIKey of methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate?
The InChIKey is WMGYLLOUHGJALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-13-8(12)6-4-10-11-3-2-9-5-7(6)11/h4,9H,2-3,5H2,1H3.
What are the key properties of methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate?
methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate has a molecular weight of 181.19 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate is sourced from PubChem (CID 131423907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).