C12H10N2S — CID 13142901
6,10-dimethyl-8-thia-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 13142901) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 6,10-dimethyl-8-thia-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 6,10-dimethyl-8-thia-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 13142901 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 6,10-dimethyl-8-thia-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Cc1ccnc2c1sc1c(C)ccnc12 |
| InChI | InChI=1S/C12H10N2S/c1-7-3-5-13-9-10-12(15-11(7)9)8(2)4-6-14-10/h3-6H,1-2H3 |
| InChIKey | ZESNVVFLMOLUEF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |