(2,2-difluorocyclobutyl)methanesulfonyl chloride

C5H7ClF2O2S — CID 131433079

IUPAC(2,2-difluorocyclobutyl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1CCC1(F)F
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)3-4-1-2-5(4,7)8/h4H,1-3H2
InChIKeyBQNJUOCVOAHAMM-UHFFFAOYSA-N
MW204.62 g/mol
LogP1.60
Rot. Bonds2

About (2,2-difluorocyclobutyl)methanesulfonyl chloride

(2,2-difluorocyclobutyl)methanesulfonyl chloride (PubChem CID 131433079) has the molecular formula C5H7ClF2O2S and a molecular weight of 204.62 g/mol. Its IUPAC name is (2,2-difluorocyclobutyl)methanesulfonyl chloride.

Molecular Properties

Compound Name(2,2-difluorocyclobutyl)methanesulfonyl chloride
PubChem CID131433079
Molecular FormulaC5H7ClF2O2S
Molecular Weight204.62 g/mol
Exact Mass203.98
IUPAC Name(2,2-difluorocyclobutyl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1CCC1(F)F
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)3-4-1-2-5(4,7)8/h4H,1-3H2
InChIKeyBQNJUOCVOAHAMM-UHFFFAOYSA-N
XLogP1.60
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.62
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2,2-difluorocyclobutyl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-difluorocyclobutyl)methanesulfonyl chloride?
The IUPAC name of (2,2-difluorocyclobutyl)methanesulfonyl chloride (CID 131433079) is (2,2-difluorocyclobutyl)methanesulfonyl chloride.
What is the SMILES notation for (2,2-difluorocyclobutyl)methanesulfonyl chloride?
The canonical SMILES for (2,2-difluorocyclobutyl)methanesulfonyl chloride is O=S(=O)(Cl)CC1CCC1(F)F.
What is the InChIKey of (2,2-difluorocyclobutyl)methanesulfonyl chloride?
The InChIKey is BQNJUOCVOAHAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClF2O2S/c6-11(9,10)3-4-1-2-5(4,7)8/h4H,1-3H2.
What are the key properties of (2,2-difluorocyclobutyl)methanesulfonyl chloride?
(2,2-difluorocyclobutyl)methanesulfonyl chloride has a molecular weight of 204.62 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluorocyclobutyl)methanesulfonyl chloride is sourced from PubChem (CID 131433079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).