C17H19NO4 — CID 13143653
dimethyl 1,2,5-trimethyl-1-benzazepine-3,4-dicarboxylate (PubChem CID 13143653) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is dimethyl 1,2,5-trimethyl-1-benzazepine-3,4-dicarboxylate.
| Compound Name | dimethyl 1,2,5-trimethyl-1-benzazepine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 13143653 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | dimethyl 1,2,5-trimethyl-1-benzazepine-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C)c2ccccc2N(C)C(C)=C1C(=O)OC |
| InChI | InChI=1S/C17H19NO4/c1-10-12-8-6-7-9-13(12)18(3)11(2)15(17(20)22-5)14(10)16(19)21-4/h6-9H,1-5H3 |
| InChIKey | ATWQERIJJUMFGT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |