About 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine
7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine (PubChem CID 13143659) has the molecular formula C18H14N4
and a molecular weight of 286.34 g/mol. Its IUPAC name is 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine.
Molecular Properties
| Compound Name | 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine |
| PubChem CID | 13143659 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine |
| SMILES | Nc1ncc2c(n1)-c1ccccc1C(c1ccccc1)=NC2 |
| InChI | InChI=1S/C18H14N4/c19-18-21-11-13-10-20-16(12-6-2-1-3-7-12)14-8-4-5-9-15(14)17(13)22-18/h1-9,11H,10H2,(H2,19,21,22) |
| InChIKey | DZPNYGJOHBPANE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
The IUPAC name of 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine (CID 13143659) is 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine.
What is the SMILES notation for 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
The canonical SMILES for 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine is Nc1ncc2c(n1)-c1ccccc1C(c1ccccc1)=NC2.
What is the InChIKey of 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
The InChIKey is DZPNYGJOHBPANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4/c19-18-21-11-13-10-20-16(12-6-2-1-3-7-12)14-8-4-5-9-15(14)17(13)22-18/h1-9,11H,10H2,(H2,19,21,22).
What are the key properties of 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine has a molecular weight of 286.34 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine is sourced from PubChem (CID 13143659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).