About N-phenylindazol-2-amine
N-phenylindazol-2-amine (PubChem CID 13143691) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-phenylindazol-2-amine.
Molecular Properties
| Compound Name | N-phenylindazol-2-amine |
| PubChem CID | 13143691 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-phenylindazol-2-amine |
| SMILES | c1ccc(Nn2cc3ccccc3n2)cc1 |
| InChI | InChI=1S/C13H11N3/c1-2-7-12(8-3-1)14-16-10-11-6-4-5-9-13(11)15-16/h1-10,14H |
| InChIKey | FBQMCWNJSPXKIK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenylindazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylindazol-2-amine?
The IUPAC name of N-phenylindazol-2-amine (CID 13143691) is N-phenylindazol-2-amine.
What is the SMILES notation for N-phenylindazol-2-amine?
The canonical SMILES for N-phenylindazol-2-amine is c1ccc(Nn2cc3ccccc3n2)cc1.
What is the InChIKey of N-phenylindazol-2-amine?
The InChIKey is FBQMCWNJSPXKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c1-2-7-12(8-3-1)14-16-10-11-6-4-5-9-13(11)15-16/h1-10,14H.
What are the key properties of N-phenylindazol-2-amine?
N-phenylindazol-2-amine has a molecular weight of 209.25 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylindazol-2-amine is sourced from PubChem (CID 13143691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).