About 2,5-dibutyl-3,6-dichloropyrazine
2,5-dibutyl-3,6-dichloropyrazine (PubChem CID 13143722) has the molecular formula C12H18Cl2N2
and a molecular weight of 261.20 g/mol. Its IUPAC name is 2,5-dibutyl-3,6-dichloropyrazine.
Molecular Properties
| Compound Name | 2,5-dibutyl-3,6-dichloropyrazine |
| PubChem CID | 13143722 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2,5-dibutyl-3,6-dichloropyrazine |
| SMILES | CCCCc1nc(Cl)c(CCCC)nc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-3-5-7-9-11(13)16-10(8-6-4-2)12(14)15-9/h3-8H2,1-2H3 |
| InChIKey | SXCQJJMBCPTSMU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dibutyl-3,6-dichloropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibutyl-3,6-dichloropyrazine?
The IUPAC name of 2,5-dibutyl-3,6-dichloropyrazine (CID 13143722) is 2,5-dibutyl-3,6-dichloropyrazine.
What is the SMILES notation for 2,5-dibutyl-3,6-dichloropyrazine?
The canonical SMILES for 2,5-dibutyl-3,6-dichloropyrazine is CCCCc1nc(Cl)c(CCCC)nc1Cl.
What is the InChIKey of 2,5-dibutyl-3,6-dichloropyrazine?
The InChIKey is SXCQJJMBCPTSMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Cl2N2/c1-3-5-7-9-11(13)16-10(8-6-4-2)12(14)15-9/h3-8H2,1-2H3.
What are the key properties of 2,5-dibutyl-3,6-dichloropyrazine?
2,5-dibutyl-3,6-dichloropyrazine has a molecular weight of 261.20 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibutyl-3,6-dichloropyrazine is sourced from PubChem (CID 13143722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).