About (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine
(Z)-2,3-dichloro-N-ethylprop-2-en-1-amine (PubChem CID 131438238) has the molecular formula C5H9Cl2N
and a molecular weight of 154.04 g/mol. Its IUPAC name is (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine |
| PubChem CID | 131438238 |
| Molecular Formula | C5H9Cl2N |
| Molecular Weight | 154.04 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine |
| SMILES | CCNC/C(Cl)=C/Cl |
| InChI | InChI=1S/C5H9Cl2N/c1-2-8-4-5(7)3-6/h3,8H,2,4H2,1H3/b5-3- |
| InChIKey | GXWSQWYUMFBAMA-HYXAFXHYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.04 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine?
The IUPAC name of (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine (CID 131438238) is (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine.
What is the SMILES notation for (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine?
The canonical SMILES for (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine is CCNC/C(Cl)=C/Cl.
What is the InChIKey of (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine?
The InChIKey is GXWSQWYUMFBAMA-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H9Cl2N/c1-2-8-4-5(7)3-6/h3,8H,2,4H2,1H3/b5-3-.
What are the key properties of (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine?
(Z)-2,3-dichloro-N-ethylprop-2-en-1-amine has a molecular weight of 154.04 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dichloro-N-ethylprop-2-en-1-amine is sourced from PubChem (CID 131438238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).