About N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine
N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine (PubChem CID 13144367) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine |
| PubChem CID | 13144367 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine |
| SMILES | Cc1cc(C)nc(NO)n1 |
| InChI | InChI=1S/C6H9N3O/c1-4-3-5(2)8-6(7-4)9-10/h3,10H,1-2H3,(H,7,8,9) |
| InChIKey | MDBKKNCBIAVHAA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine (CID 13144367) is N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine is Cc1cc(C)nc(NO)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine?
The InChIKey is MDBKKNCBIAVHAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-4-3-5(2)8-6(7-4)9-10/h3,10H,1-2H3,(H,7,8,9).
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine?
N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine has a molecular weight of 139.16 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)hydroxylamine is sourced from PubChem (CID 13144367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).