C6H2ClF5N2 — CID 131444079
3-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridazine (PubChem CID 131444079) has the molecular formula C6H2ClF5N2 and a molecular weight of 232.54 g/mol. Its IUPAC name is 3-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridazine.
| Compound Name | 3-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridazine |
|---|---|
| PubChem CID | 131444079 |
| Molecular Formula | C6H2ClF5N2 |
| Molecular Weight | 232.54 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 3-chloro-5-(1,1,2,2,2-pentafluoroethyl)pyridazine |
| SMILES | FC(F)(F)C(F)(F)c1cnnc(Cl)c1 |
| InChI | InChI=1S/C6H2ClF5N2/c7-4-1-3(2-13-14-4)5(8,9)6(10,11)12/h1-2H |
| InChIKey | SSUCOPIACIBZKJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|