C9H10ClN3O4 — CID 13144512
2-(2-chloroethyl)-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid (PubChem CID 13144512) has the molecular formula C9H10ClN3O4 and a molecular weight of 259.65 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid.
| Compound Name | 2-(2-chloroethyl)-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid |
|---|---|
| PubChem CID | 13144512 |
| Molecular Formula | C9H10ClN3O4 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(2-chloroethyl)-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid |
| SMILES | O=C(O)C1C=CCn2c(=O)n(CCCl)c(=O)n21 |
| InChI | InChI=1S/C9H10ClN3O4/c10-3-5-11-8(16)12-4-1-2-6(7(14)15)13(12)9(11)17/h1-2,6H,3-5H2,(H,14,15) |
| InChIKey | OFOZOJDLDTXWBF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|