C11H4Cl2N2O — CID 13144596
5,11-dichloro-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one (PubChem CID 13144596) has the molecular formula C11H4Cl2N2O and a molecular weight of 251.07 g/mol. Its IUPAC name is 5,11-dichloro-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one.
| Compound Name | 5,11-dichloro-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
|---|---|
| PubChem CID | 13144596 |
| Molecular Formula | C11H4Cl2N2O |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 5,11-dichloro-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
| SMILES | O=C1c2nc(Cl)ccc2-c2ccc(Cl)nc21 |
| InChI | InChI=1S/C11H4Cl2N2O/c12-7-3-1-5-6-2-4-8(13)15-10(6)11(16)9(5)14-7/h1-4H |
| InChIKey | WKSYGNARPCDQSR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|