About 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone
1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 13144634) has the molecular formula C8H9F3N2OS
and a molecular weight of 238.23 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone |
| PubChem CID | 13144634 |
| Molecular Formula | C8H9F3N2OS |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | Cc1nc(N(C)C)sc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2OS/c1-4-5(6(14)8(9,10)11)15-7(12-4)13(2)3/h1-3H3 |
| InChIKey | UHDBMMALADJBRS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone?
The IUPAC name of 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone (CID 13144634) is 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone?
The canonical SMILES for 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone is Cc1nc(N(C)C)sc1C(=O)C(F)(F)F.
What is the InChIKey of 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone?
The InChIKey is UHDBMMALADJBRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2OS/c1-4-5(6(14)8(9,10)11)15-7(12-4)13(2)3/h1-3H3.
What are the key properties of 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone?
1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone has a molecular weight of 238.23 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone is sourced from PubChem (CID 13144634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).