C11H11ClN2O2 — CID 131449396
ethyl 6-(chloromethyl)-1H-benzimidazole-4-carboxylate (PubChem CID 131449396) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is ethyl 6-(chloromethyl)-1H-benzimidazole-4-carboxylate.
| Compound Name | ethyl 6-(chloromethyl)-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 131449396 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | ethyl 6-(chloromethyl)-1H-benzimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cc(CCl)cc2[nH]cnc12 |
| InChI | InChI=1S/C11H11ClN2O2/c1-2-16-11(15)8-3-7(5-12)4-9-10(8)14-6-13-9/h3-4,6H,2,5H2,1H3,(H,13,14) |
| InChIKey | XZLVZJYKPGGKIR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|