About dibenzofuran-4-thiol
dibenzofuran-4-thiol (PubChem CID 13144956) has the molecular formula C12H8OS
and a molecular weight of 200.26 g/mol. Its IUPAC name is dibenzofuran-4-thiol.
Molecular Properties
| Compound Name | dibenzofuran-4-thiol |
| PubChem CID | 13144956 |
| Molecular Formula | C12H8OS |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | dibenzofuran-4-thiol |
| SMILES | Sc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C12H8OS/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,14H |
| InChIKey | PDRFPOLGLQXCRD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dibenzofuran-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-4-thiol?
The IUPAC name of dibenzofuran-4-thiol (CID 13144956) is dibenzofuran-4-thiol.
What is the SMILES notation for dibenzofuran-4-thiol?
The canonical SMILES for dibenzofuran-4-thiol is Sc1cccc2c1oc1ccccc12.
What is the InChIKey of dibenzofuran-4-thiol?
The InChIKey is PDRFPOLGLQXCRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8OS/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,14H.
What are the key properties of dibenzofuran-4-thiol?
dibenzofuran-4-thiol has a molecular weight of 200.26 g/mol, XLogP of 3.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-4-thiol is sourced from PubChem (CID 13144956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).