ethoxy(methyl)phosphinous acid

C3H9O2P — CID 13145048

IUPACethoxy(methyl)phosphinous acid
SMILESCCOP(C)O
InChIInChI=1S/C3H9O2P/c1-3-5-6(2)4/h4H,3H2,1-2H3
InChIKeyGZBQGSURWYXEQF-UHFFFAOYSA-N
MW108.08 g/mol
LogP0.96
Rot. Bonds2

About ethoxy(methyl)phosphinous acid

ethoxy(methyl)phosphinous acid (PubChem CID 13145048) has the molecular formula C3H9O2P and a molecular weight of 108.08 g/mol. Its IUPAC name is ethoxy(methyl)phosphinous acid.

Molecular Properties

Compound Nameethoxy(methyl)phosphinous acid
PubChem CID13145048
Molecular FormulaC3H9O2P
Molecular Weight108.08 g/mol
Exact Mass108.03
IUPAC Nameethoxy(methyl)phosphinous acid
SMILESCCOP(C)O
InChIInChI=1S/C3H9O2P/c1-3-5-6(2)4/h4H,3H2,1-2H3
InChIKeyGZBQGSURWYXEQF-UHFFFAOYSA-N
XLogP0.96
TPSA29.46 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.08
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze ethoxy(methyl)phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethoxy(methyl)phosphinous acid?
The IUPAC name of ethoxy(methyl)phosphinous acid (CID 13145048) is ethoxy(methyl)phosphinous acid.
What is the SMILES notation for ethoxy(methyl)phosphinous acid?
The canonical SMILES for ethoxy(methyl)phosphinous acid is CCOP(C)O.
What is the InChIKey of ethoxy(methyl)phosphinous acid?
The InChIKey is GZBQGSURWYXEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O2P/c1-3-5-6(2)4/h4H,3H2,1-2H3.
What are the key properties of ethoxy(methyl)phosphinous acid?
ethoxy(methyl)phosphinous acid has a molecular weight of 108.08 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(methyl)phosphinous acid is sourced from PubChem (CID 13145048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).