C15H13ClO2 — CID 13145296
(2Z)-2-[(4-chlorophenyl)methylidene]-4,5,6,7-tetrahydro-1-benzofuran-3-one (PubChem CID 13145296) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is (2Z)-2-[(4-chlorophenyl)methylidene]-4,5,6,7-tetrahydro-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(4-chlorophenyl)methylidene]-4,5,6,7-tetrahydro-1-benzofuran-3-one |
|---|---|
| PubChem CID | 13145296 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (2Z)-2-[(4-chlorophenyl)methylidene]-4,5,6,7-tetrahydro-1-benzofuran-3-one |
| SMILES | O=C1C2=C(CCCC2)O/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClO2/c16-11-7-5-10(6-8-11)9-14-15(17)12-3-1-2-4-13(12)18-14/h5-9H,1-4H2/b14-9- |
| InChIKey | PUPMDUNBHOCZNN-ZROIWOOFSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|