About [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine
[1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine (PubChem CID 131460343) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine |
| PubChem CID | 131460343 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine |
| SMILES | Cc1cc(C)cc(C2(CN)CC2(C)C)c1 |
| InChI | InChI=1S/C14H21N/c1-10-5-11(2)7-12(6-10)14(9-15)8-13(14,3)4/h5-7H,8-9,15H2,1-4H3 |
| InChIKey | WWSHEWFFJXHKDS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine?
The IUPAC name of [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine (CID 131460343) is [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine.
What is the SMILES notation for [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine?
The canonical SMILES for [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine is Cc1cc(C)cc(C2(CN)CC2(C)C)c1.
What is the InChIKey of [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine?
The InChIKey is WWSHEWFFJXHKDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-10-5-11(2)7-12(6-10)14(9-15)8-13(14,3)4/h5-7H,8-9,15H2,1-4H3.
What are the key properties of [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine?
[1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine has a molecular weight of 203.33 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-dimethylphenyl)-2,2-dimethylcyclopropyl]methanamine is sourced from PubChem (CID 131460343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).