9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid

C10H16O5S — CID 131461751

IUPAC9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid
SMILESO=C(O)C1CCOC2(CCS(=O)(=O)CC2)C1
InChIInChI=1S/C10H16O5S/c11-9(12)8-1-4-15-10(7-8)2-5-16(13,14)6-3-10/h8H,1-7H2,(H,11,12)
InChIKeyIJPWVDLMHYWIQZ-UHFFFAOYSA-N
MW248.30 g/mol
LogP0.44
Rot. Bonds1

About 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid

9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid (PubChem CID 131461751) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid.

Molecular Properties

Compound Name9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid
PubChem CID131461751
Molecular FormulaC10H16O5S
Molecular Weight248.30 g/mol
Exact Mass248.07
IUPAC Name9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid
SMILESO=C(O)C1CCOC2(CCS(=O)(=O)CC2)C1
InChIInChI=1S/C10H16O5S/c11-9(12)8-1-4-15-10(7-8)2-5-16(13,14)6-3-10/h8H,1-7H2,(H,11,12)
InChIKeyIJPWVDLMHYWIQZ-UHFFFAOYSA-N
XLogP0.44
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.30
LogP ≤ 50.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid?
The IUPAC name of 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid (CID 131461751) is 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid.
What is the SMILES notation for 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid?
The canonical SMILES for 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid is O=C(O)C1CCOC2(CCS(=O)(=O)CC2)C1.
What is the InChIKey of 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid?
The InChIKey is IJPWVDLMHYWIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5S/c11-9(12)8-1-4-15-10(7-8)2-5-16(13,14)6-3-10/h8H,1-7H2,(H,11,12).
What are the key properties of 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid?
9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid has a molecular weight of 248.30 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dioxo-1-oxa-9λ6-thiaspiro[5.5]undecane-4-carboxylic acid is sourced from PubChem (CID 131461751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).