About 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile
2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile (PubChem CID 131461933) has the molecular formula C12H12Cl2N2
and a molecular weight of 255.15 g/mol. Its IUPAC name is 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile |
| PubChem CID | 131461933 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Cl)c1[C@H](N)C1CCC1 |
| InChI | InChI=1S/C12H12Cl2N2/c13-9-4-8(6-15)11(10(14)5-9)12(16)7-2-1-3-7/h4-5,7,12H,1-3,16H2/t12-/m1/s1 |
| InChIKey | UJWGFMGVLDROCJ-GFCCVEGCSA-N |
| XLogP | 3.66 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile?
The IUPAC name of 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile (CID 131461933) is 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile.
What is the SMILES notation for 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile?
The canonical SMILES for 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile is N#Cc1cc(Cl)cc(Cl)c1[C@H](N)C1CCC1.
What is the InChIKey of 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile?
The InChIKey is UJWGFMGVLDROCJ-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H12Cl2N2/c13-9-4-8(6-15)11(10(14)5-9)12(16)7-2-1-3-7/h4-5,7,12H,1-3,16H2/t12-/m1/s1.
What are the key properties of 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile?
2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile has a molecular weight of 255.15 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(R)-amino(cyclobutyl)methyl]-3,5-dichlorobenzonitrile is sourced from PubChem (CID 131461933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).