About [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate
[1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate (PubChem CID 13146453) has the molecular formula C13H18F2O6S
and a molecular weight of 340.34 g/mol. Its IUPAC name is [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate |
| PubChem CID | 13146453 |
| Molecular Formula | C13H18F2O6S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate |
| SMILES | COC(OC)(c1ccc(OC(F)F)cc1)C(C)OS(C)(=O)=O |
| InChI | InChI=1S/C13H18F2O6S/c1-9(21-22(4,16)17)13(18-2,19-3)10-5-7-11(8-6-10)20-12(14)15/h5-9,12H,1-4H3 |
| InChIKey | QICGLPOQMNGMMP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate?
The IUPAC name of [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate (CID 13146453) is [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate.
What is the SMILES notation for [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate?
The canonical SMILES for [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate is COC(OC)(c1ccc(OC(F)F)cc1)C(C)OS(C)(=O)=O.
What is the InChIKey of [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate?
The InChIKey is QICGLPOQMNGMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2O6S/c1-9(21-22(4,16)17)13(18-2,19-3)10-5-7-11(8-6-10)20-12(14)15/h5-9,12H,1-4H3.
What are the key properties of [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate?
[1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate has a molecular weight of 340.34 g/mol, XLogP of 2.10, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxypropan-2-yl] methanesulfonate is sourced from PubChem (CID 13146453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).