About tert-butyl (E)-dec-2-enoate
tert-butyl (E)-dec-2-enoate (PubChem CID 13146798) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is tert-butyl (E)-dec-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-dec-2-enoate |
| PubChem CID | 13146798 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | tert-butyl (E)-dec-2-enoate |
| SMILES | CCCCCCC/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-5-6-7-8-9-10-11-12-13(15)16-14(2,3)4/h11-12H,5-10H2,1-4H3/b12-11+ |
| InChIKey | JBQPOENDUWMBPH-VAWYXSNFSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-dec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-dec-2-enoate?
The IUPAC name of tert-butyl (E)-dec-2-enoate (CID 13146798) is tert-butyl (E)-dec-2-enoate.
What is the SMILES notation for tert-butyl (E)-dec-2-enoate?
The canonical SMILES for tert-butyl (E)-dec-2-enoate is CCCCCCC/C=C/C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (E)-dec-2-enoate?
The InChIKey is JBQPOENDUWMBPH-VAWYXSNFSA-N. The full InChI is InChI=1S/C14H26O2/c1-5-6-7-8-9-10-11-12-13(15)16-14(2,3)4/h11-12H,5-10H2,1-4H3/b12-11+.
What are the key properties of tert-butyl (E)-dec-2-enoate?
tert-butyl (E)-dec-2-enoate has a molecular weight of 226.36 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-dec-2-enoate is sourced from PubChem (CID 13146798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).