C7H3ClF3N3O3S — CID 131468991
2-amino-4-cyano-5-(trifluoromethoxy)pyridine-3-sulfonyl chloride (PubChem CID 131468991) has the molecular formula C7H3ClF3N3O3S and a molecular weight of 301.63 g/mol. Its IUPAC name is 2-amino-4-cyano-5-(trifluoromethoxy)pyridine-3-sulfonyl chloride.
| Compound Name | 2-amino-4-cyano-5-(trifluoromethoxy)pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 131468991 |
| Molecular Formula | C7H3ClF3N3O3S |
| Molecular Weight | 301.63 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 2-amino-4-cyano-5-(trifluoromethoxy)pyridine-3-sulfonyl chloride |
| SMILES | N#Cc1c(OC(F)(F)F)cnc(N)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H3ClF3N3O3S/c8-18(15,16)5-3(1-12)4(2-14-6(5)13)17-7(9,10)11/h2H,(H2,13,14) |
| InChIKey | LGINTZUVLXNBLQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.63 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |