C15H26O2 — CID 13146910
2,2,6,6-tetramethyl-7-(2-methylprop-2-enoxy)cycloheptan-1-one (PubChem CID 13146910) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-7-(2-methylprop-2-enoxy)cycloheptan-1-one.
| Compound Name | 2,2,6,6-tetramethyl-7-(2-methylprop-2-enoxy)cycloheptan-1-one |
|---|---|
| PubChem CID | 13146910 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-7-(2-methylprop-2-enoxy)cycloheptan-1-one |
| SMILES | C=C(C)COC1C(=O)C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C15H26O2/c1-11(2)10-17-13-12(16)14(3,4)8-7-9-15(13,5)6/h13H,1,7-10H2,2-6H3 |
| InChIKey | OGNJVRSTPFFQCQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|