About 1-chloro-2-methoxyhexane
1-chloro-2-methoxyhexane (PubChem CID 13146996) has the molecular formula C7H15ClO
and a molecular weight of 150.65 g/mol. Its IUPAC name is 1-chloro-2-methoxyhexane.
Molecular Properties
| Compound Name | 1-chloro-2-methoxyhexane |
| PubChem CID | 13146996 |
| Molecular Formula | C7H15ClO |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-chloro-2-methoxyhexane |
| SMILES | CCCCC(CCl)OC |
| InChI | InChI=1S/C7H15ClO/c1-3-4-5-7(6-8)9-2/h7H,3-6H2,1-2H3 |
| InChIKey | YUWMZCLEOPIDFY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-methoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methoxyhexane?
The IUPAC name of 1-chloro-2-methoxyhexane (CID 13146996) is 1-chloro-2-methoxyhexane.
What is the SMILES notation for 1-chloro-2-methoxyhexane?
The canonical SMILES for 1-chloro-2-methoxyhexane is CCCCC(CCl)OC.
What is the InChIKey of 1-chloro-2-methoxyhexane?
The InChIKey is YUWMZCLEOPIDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15ClO/c1-3-4-5-7(6-8)9-2/h7H,3-6H2,1-2H3.
What are the key properties of 1-chloro-2-methoxyhexane?
1-chloro-2-methoxyhexane has a molecular weight of 150.65 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methoxyhexane is sourced from PubChem (CID 13146996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).