C16H9NO — CID 13147660
16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one (PubChem CID 13147660) has the molecular formula C16H9NO and a molecular weight of 231.25 g/mol. Its IUPAC name is 16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one.
| Compound Name | 16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one |
|---|---|
| PubChem CID | 13147660 |
| Molecular Formula | C16H9NO |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one |
| SMILES | O=C1c2ccccc2-c2nccc3cccc1c23 |
| InChI | InChI=1S/C16H9NO/c18-16-12-6-2-1-5-11(12)15-14-10(8-9-17-15)4-3-7-13(14)16/h1-9H |
| InChIKey | INSNNVNWDYCOBU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |