C17H28BN3O2 — CID 131478542
1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (PubChem CID 131478542) has the molecular formula C17H28BN3O2 and a molecular weight of 317.24 g/mol. Its IUPAC name is 1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine.
| Compound Name | 1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 131478542 |
| Molecular Formula | C17H28BN3O2 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | 1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| SMILES | CCN1CCN(c2cc(B3OC(C)(C)C(C)(C)O3)ccn2)CC1 |
| InChI | InChI=1S/C17H28BN3O2/c1-6-20-9-11-21(12-10-20)15-13-14(7-8-19-15)18-22-16(2,3)17(4,5)23-18/h7-8,13H,6,9-12H2,1-5H3 |
| InChIKey | KORGSISKSQUJAS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|