C29H28O2P2 — CID 13147872
[(4R,5R)-5-diphenylphosphanyl-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylphosphane (PubChem CID 13147872) has the molecular formula C29H28O2P2 and a molecular weight of 470.49 g/mol. Its IUPAC name is [(4R,5R)-5-diphenylphosphanyl-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylphosphane.
| Compound Name | [(4R,5R)-5-diphenylphosphanyl-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 13147872 |
| Molecular Formula | C29H28O2P2 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [(4R,5R)-5-diphenylphosphanyl-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylphosphane |
| SMILES | CC1(C)O[C@H](P(c2ccccc2)c2ccccc2)[C@@H](P(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C29H28O2P2/c1-29(2)30-27(32(23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(31-29)33(25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27-28H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | VIOPLOABZSDFIY-VSGBNLITSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|